Перейти к публикации
Форум химиков на XuMuK.ru

RMOB

Пользователи
  • Публикации

    95
  • Зарегистрирован

  • Посещение

Репутация

5

Посетители профиля

Блок посетителей профиля отключен и не будет отображаться другим пользователям

  1. https://www.webqc.org/balance.php?reaction=NH4NO3%2BH2SO4%3D(NH4)2SO4%2BHNO3 к 10 граммам NH4NO3 надо добавить 6,1 гр. H2SO4. У меня кислота 70%. Сколько надо взять милилитров кислоты? как расчитать?
  2. https://www.webqc.org/balance.php?reaction=NH4NO3%2BH2SO4%3D(NH4)2SO4%2BHNO3
  3. Расчитать NH4NO3+H2SO4=(NH4)2SO4+HNO3 к 10 граммам NH4NO3 надо добавить 6,1 гр. H2SO4. У меня кислота 70%. Сколько надо взять милилитров кислоты? как расчитать? https://www.webqc.org/balance.php?reaction=NH4NO3%2BH2SO4%3D(NH4)2SO4%2BHNO3
  4. RMOB

    Электролизер от сети 220В

    забудь. очень глупая идея
  5. RMOB

    Молекулярные сита

    Какой типы молекулярных сит нужен что бы задержать азот но пропустуть кислород? Хочу понять как работатет Кислородный концентратор.
  6. генетика и не говорит что ты 100% толстый будешь, она говорит если у тебя склоность к ожирению или нет. у нас все худые. я тупо жру и пью, и все равно стройный. вот что значат гены.
  7. наивный вы как 5 копеек. гены решают все и вес тоже.
  8. я знаю нафион это протонная мембрана. но стоит бешенные деньгн :(
  9. https://chem21.info/page/169100192033085154235088159059156167002226163190/
  10. В другой книге 2FeCl2 + 2H20 + 1/2О2 = Fe2O3 + 4HCl при температуре 350-550. Термогидролиз FeCl2 при температуре 800.
  11. У меня нет слов, кругом одни упрямые идиоты.
  12. Вы не правы. Это метод регенерацыи кислот из травильных растворов.
  13. Можно получить серную кислоту из сульфата например магния (железа) с помощью ионнообменной смолы?
  14. 1. FeSO4+2HCl=H2SO4+FeCl2 2. FeCl2 + H20 = FeO+ 2HCl 1. HCL в виде газа? 2. какая температура?
×
×
  • Создать...