Перейти к содержимому
Форум химиков на XuMuK.ru

aвrora

Пользователи
  • Публикации

    10
  • Зарегистрирован

  • Посещение

Репутация

0
  1. aвrora

    белая магнезия

    как уровнять уравнение белая магнезия + hcl ?
  2. aвrora

    простые эфиры

    как из бутилового спирта получить 2 бутоксибутановую кислоту
  3. aвrora

    гравиметрия

    помогите пожалуйста хотя бы формулы подскажите Рассчитать титр серебра в растворе нитрата серебра, если из его пробы объёмом 99,23 мл получили 0,1220 г прокаленного осадка. Укажите весовую форму, если форма осаждения - хлорид серебра.
  4. aвrora

    проверьте решение

    Рассчитать буферную ёмкость раствора, содержащего 0,444 моль/л хлорида метиламмония и 0,6 моль/л метиламина. буферная емкость=2.3*((0.444*0,6)/(0.444+0.6))
  5. помогите решить Рассчитать мольную долю H2PO4- в растворе фосфорной кислоты при рН = 2.71
  6. aвrora

    задача на ph

    Рассчитайте массу формиата калия, который необходимо добавить к 8 мл 0,49 раствора муравьиной кислоты, чтобы получить раствор с водородным показателем 3,9.
  7. aвrora

    ph буферов

    а как вычислить степень диссоциации.
  8. aвrora

    ph буферов

    со второй задачей может так ph=pKa(этиламина)-lg(n(этиламина)/n(с2h3nh3cl))
  9. aвrora

    ph буферов

    с этиламином никаких идей нет :( я там даже реакцию не представляю а на счет первой ch3coona+hcl=ch3cooh+nacl ph=pKa-lg(n(ch3coo-)/n(ch3cooh)) pKa=4.74 n(ch3coo-)=n(ch3coona) n(ch3cooh)=n(hcl) ph=pKa-lg(nкислоты/nкислоты-nоснования) вот как то так
  10. aвrora

    ph буферов

    1.Рассчитайте водородный показатель раствора и степень диссоциации слабой кислоты, полученного при добавлении 0,428 грамм ацетата натрия к 8,0 мл 0,675 молярного раствора хлороводородной кислоты. 2. Рассчитайте водородный показатель раствора, полученного при смешении 19 мл 0,21 молярного раствора этиламина и 15 мл 0,35 раствора хлорида этиламмония.
×