Перейти к содержимому
Форум химиков на XuMuK.ru

Мария1983

Пользователи
  • Публикации

    21
  • Зарегистрирован

  • Посещение

Репутация

0
  1. Константа скорости реакции 2SbH3газ → 2Sb тв + 3H2 газ при 300 ˚С равна 0,04 час-1. Сколько граммов сурьмы образуется через 8 часов после начала реакции, если 0,5 моля гидрида сурьмы поместить в нагретый до 300 ˚С сосуд емкостью 20 л? Какое давление установится при этом в сосуде?
  2. какова молярность раствора пероксида водорода, если для количественного взаимодействия с 25 мл 0,02 М раствора перманганата калия в кислой среде израсходован такой же его обьем?
  3. Органическая цепочка уравнений. Все решалось логично и тут я застопорилась. В последнем уравнении по идее должно получаться галогензамещенное либо что-то -еновое... иначе последняя реакция не выводит ни к чему. Может по ходу решения я что-то упустила? вроде все логично и правильно, проверьте пожалуйста помогите мыслью... CH3-CH(CH3)-COOH + Cl2 (Pкр ) = CH3-CCl(CH3)-COOH + HCl CH3-CCl(CH3)-COOH + KOH (спирт) = CH2=C(CH3)-COOH + KCl CH2=C(CH3)-COOH + HBr → CH3-CBr(CH3)-COOH CH3-CBr(CH3)-COOH + Mg (абс.эфир) = CH3-C(MgBr)(CH3)-COOH CH3-C(MgBr)(CH3)-COOH + CO2 → BrMgO-(O)C-C(CH3)(CH3)-COOH BrMgO-(O)C-C(CH3)(CH3)-COOH + H2O (HCl) = COOH-C(CH3)(CH3)-COOH + Mg(OH)Br COOH-C(CH3)(CH3)-COOH (t°C) = CH(CH3)(CH3)-COOH + CO2 CH(CH3)(CH3)-COOH + NH3 = ????
  4. Мария1983

    Вопрос по задаче по теме электрохимия.

    Разобралась! Спасибо!!!
  5. Найти потенциал электрода, полученного погружением Pt проволоки в раствор приведенного состава. 0,01 М KCLO3 + 0,001 M KCL, pH = 1 Не понимаю с какой стороны можно подступиться к задаче. Подскажите, наведите на верную мысль, уважаемые химики!
  6. Рассчитайте степень электролитической диссоциации сульфата магния в 0,01 моль/л растворе, замерзающем при -0,027°С. Плотность раствора принять равной 1,015 г/см3.
  7. Рассчитать работу, совершаемую при расширении 4,4 г диоксида углерода от объема 1500 мл до объема 900 мл при постоянном давлении 1,3 атм . Решение Работа газа при постоянном давлении: A=p · ΔV = 1317225 Н/м2 · 0,0006 м3 ≈ 790 Дж Не могу понять для чего дана масса газа?
  8. Мария1983

    Объемная доля

    Спасибо!!!
  9. Мария1983

    Объемная доля

    Рассчитайте объемную долю (%) озона в кислороде, если при пропускании 11,2 л озонированного кислорода через раствор KI, выделилось 1,016 г йода. Реакцию записала: 2KI + O3 + H2O = I2 + 2KOH + O2 Соотвественно, n (O3) = n (I2); n (O3) = 11,2/22,4 = 0,5 моль. Не могу понять как решать дальше. Подскажите, пожалуйста!
  10. Мария1983

    Электродный потенциал

    Спасибо всем! Поняла!
  11. Мария1983

    Электродный потенциал

    надо найти электродный потенциал в первом случае, а потом во втором и отнять?
  12. Мария1983

    Электродный потенциал

    а как к этому ответу придти? я не могу понять именно ход решения. наведите на мысль, пожалуйста
  13. Мария1983

    Электродный потенциал

    Вычислить, как изменится электродный потенциал цинка, если концентрация растора ZnSO4, в который погружена цинковая пластинка, уменьшится от 0,1 до 0,01 н.
  14. Мария1983

    Как можно из латуни получить металлический цинк?

    Да. чисто теоретически. Спасибо! Очень помогли!
  15. Перерыла горы литературы, ответа найти не могу(( Как можно из латуни получить металлический цинк?
×