Перейти к публикации
Форум химиков на XuMuK.ru
В розницу физическим лицам. Фасовки от 100 грамм. Удобная доставка по России в пункты выдачи, почтой или транспортными компаниями.
Arfa

ОВР: ионно-электронный способ.

Рекомендованные сообщения

Дана задача:

 

Подобрать коэффициенты в следующих окислительно-восстановительных реакциях методом электронно-ионного баланса:

 

NaI+K2Cr2O7+H2SO4=>I2+Cr2(SO4)3+Na2SO4+K2SO4+H2O

 

 

PbCrO4+KI+HCl=>CrCl3+I2+PbCl2+KCl+H2O

Поделиться сообщением


Ссылка на сообщение

Подобрать коэффициенты в следующих окислительно-восстановительных реакциях методом электронно-ионного баланса:

NaI+K2Cr2O7+H2SO4=>I2+Cr2(SO4) 3+Na2SO4+K2SO4+H2O

2I- - 2e = I2 |3

Cr2O72- + 6e + 14H+ = 2Cr3+ + 7H2O |1

6I- + Cr2O72- + 14H+ =3I2 + 2Cr3+ + 7H2O

6NaI + K2Cr2O7 + 7H2SO4 => 3I2 + Cr2(SO4)3 + 3Na2SO4 + K2SO4 + 7H2O

Поделиться сообщением


Ссылка на сообщение

PbCrO4+KI+HCl=>CrCl3+I2+PbCl2+KCl+H2O

PbCrO4 + 8H+ + 2Cl- + 3e = PbCl2 + Cr3+ + 4H2O

I- - e = 1/2I2

 

2PbCrO4 + 6KI + 18HCl => 2CrCl3 + 3I2 + 2PbCl2 + 6KCl + 8H2O

Поделиться сообщением


Ссылка на сообщение

N2H4+KClO3+KOH=???? подскажите, пожалуйста, продукты реакции

В нете ничего не нашлось...

Поделиться сообщением


Ссылка на сообщение

N2H4+KClO3+KOH=???? подскажите, пожалуйста, продукты реакции

В нете ничего не нашлось...

 

N2H4 + KClO3 = N2 + KCl + H2O

N2H4 + 4OH- - 4e = N2 + 4H2O |3

ClO3- + 3H2O + 6e = Cl- + 6OH- |2

3N2H4 + 12OH-+ 2ClO3- + 6H2O = 3N2 + 12H2O + 2Cl- + 12OH-

3N2H4+ 2ClO3- = 3N2 + 6H2O + 2Cl-

 

3N2H4 + 2KClO3 = 3N2 + 2KCl + 6H2O

Поделиться сообщением


Ссылка на сообщение

Уравнять методом электронно-ионных уравнений реакции, протекающие в водном растворе, указать окислитель и восстановитель:

 

ClO2+NaBr+H2SO4 → HCl+Br2+Na2SO4+H2O

 

и

 

Fe(OH)3+Br2+KOH → K2FeO4+KBr+H2O

Поделиться сообщением


Ссылка на сообщение

ClO2+NaBr+H2SO4 → HCl+Br2+Na2SO4+H2O

 

ClO2 + 5e + 4H+ = Cl- + 2H2O |2

2Br- + 2e = Br2 |5

2ClO2 + 8H+ + 10Br- = 2Cl- + 4H2O + 5Br2

2ClO2 + 10NaBr + 5H2SO4 = 2HCl + 5Br2 + 5Na2SO4 + 4H2O

Поделиться сообщением


Ссылка на сообщение

Fe(OH)3+Br2+KOH → K2FeO4+KBr+H2O

 

Fe(OH)3 + 5OH- - 3e = FeO42- + 4H2O |2

Br2 + 2e = 2Br- |3

2Fe(OH)3 + 10OH- + 3Br2 = 2FeO42- + 8H2O + 6Br-

2Fe(OH)3 + 3Br2 + 10KOH → 2K2FeO4 + 6KBr + 8H2O

Поделиться сообщением


Ссылка на сообщение

Присоединяйтесь к обсуждению

Вы можете опубликовать сообщение сейчас, а зарегистрироваться позже. Если у вас есть аккаунт, войдите в него для написания от своего имени.
Примечание: вашему сообщению потребуется утверждение модератора, прежде чем оно станет доступным.

Гость
Ответить в тему...

×   Вставлено в виде отформатированного текста.   Вставить в виде обычного текста

  Разрешено не более 75 эмодзи.

×   Ваша ссылка была автоматически встроена.   Отобразить как ссылку

×   Ваш предыдущий контент был восстановлен.   Очистить редактор

×   Вы не можете вставить изображения напрямую. Загрузите или вставьте изображения по ссылке.

Загрузка...

  • Сейчас на странице   0 пользователей

    Нет пользователей, просматривающих эту страницу.

×
×
  • Создать...