Перейти к публикации
Форум химиков на XuMuK.ru

VIKADOL

Пользователи
  • Публикации

    7
  • Зарегистрирован

  • Посещение

Репутация

0
  1. Помогите пожалуйста! Уравняйте предложенные реакции методом электронного баланса, укажите окислитель и восстановитель. Al+HNO3=Al(NO3)3+N2+H2O KClO3=KCl + O2 KBrO3+KBr+ H2SO4=Br2+ K2SO4+ H2O Ca+HNO3=Ca(NO3)2+NH4NO3+H2O NaNO2+KI+HCl=NaCl+KCl+NO+H2O FeSO4+NaNO3+H2SO4=Fe2(SO4)3+NO+Na2SO4+ H2O Pb(NO3)2= PbO+NO2+O2 AgNO3+ H3PO3+ H2O=Ag+ H3PO4+ HNO3 P+HNO3+H2O= H3PO4+NO
  2. VIKADOL

    Химические реакции

    А ещё не поможете? 1. Написать реакции гидролиза солей (фосфат калия и сульфат амония) и указать для первой соли факторы, ослабляющие гидролиз, а для второй - усиливающие. 2. Даны основание и кислота. Составить все возможные соли и назвать их. гидроксид железа (III) и хромовая кислота гидроксид кальция и о-сурьмянистая кислота гидроксид хрома (III) и сероводородная кислота
  3. VIKADOL

    Химические реакции

    Спасибо огромное!!!!
  4. Дописать уравнения реакции, назвать продукты реакции. Pb(NO3)2 + [Ag(NH3)2]2CrO4 = AgNO3 + [Cu(NH3)4]Cl2 = ZnSO4 + (NH4)2[Hg(SCN)4] = [Zn(NH3)4](OH)2 + Al2(SO4)3 = FeCl3 + K4[Fe(CN)6] = [Cr(H2O)6]Cl3 + Pb(NO3)2 =
  5. А с этим помогите!!! Дописать уравнения реакции, назвать продукты реакции. Pb(NO3)2 + [Ag(NH3)2]2CrO4 = AgNO3 + [Cu(NH3)4]Cl2 = ZnSO4 + (NH4)2[Hg(SCN)4] = [Zn(NH3)4](OH)2 + Al2(SO4)3 = FeCl3 + K4[Fe(CN)6] = [Cr(H2O)6]Cl3 + Pb(NO3)2 =
  6. Помогите пожалуйста! Дописать уравнения реакции, назвать продукты реакции. Pb(NO3)2 + [Ag(NH3)2]2CrO4 = AgNO3 + [Cu(NH3)4]Cl2 = ZnSO4 + (NH4)2[Hg(SCN)4] = [Zn(NH3)4](OH)2 + Al2(SO4)3 = FeCl3 + K4[Fe(CN)6] = [Cr(H2O)6]Cl3 + Pb(NO3)2 = Дописать уравнения реакций, назвать полученные соединения, разобрать структуру комплексных соединений. FeF3 +KF = Ag3PO4+ NH4OH = NaNO2 + Co(NO2)3 = HgCl2 + NaCl = Hg(NO3)2 + NH4OH = AgCN + KCN = Fe(SCN)3 + NH4SCN = CuCl2 + HCl = Ag2CrO4 + NH4OH =
  7. Помогите пожалуйста!!! Дописать уравнения реакций, назвать полученные соединения, разобрать структуру комплексных соединений. FeF3 +KF = Ag3PO4+ NH4OH = NaNO2 + Co(NO2)3 = HgCl2 + NaCl = Hg(NO3)2 + NH4OH = AgCN + KCN = Fe(SCN)3 + NH4SCN = CuCl2 + HCl = Ag2CrO4 + NH4OH = Дописать уравнения реакции, назвать продукты реакции. Pb(NO3)2 + [Ag(NH3)2]2CrO4 = AgNO3 + [Cu(NH3)4]Cl2 = ZnSO4 + (NH4)2[Hg(SCN)4] = [Zn(NH3)4](OH)2 + Al2(SO4)3 = FeCl3 + K4[Fe(CN)6] = [Cr(H2O)6]Cl3 + Pb(NO3)2 = Спасибо!
×
×
  • Создать...
Яндекс.Метрика