Перейти к содержанию


  • Постов

  • Зарегистрирован

  • Посещение

Весь контент Nataly1994

  1. Образуется ли осадок сульфида ртути, если к 1 л 0,01М раствора тетраидомеркуриата (II) калия, содержащего 0,05моль йодида калия, добавить такое количество моль сульфид-ионов, которое содержится в 1л насыщеного раствора сульфида калия?
  2. помогите пожалуйста составить баланс NH3 + CaOCl2 = N2H4 + CaCl2 + H2O
  3. Определите какой объем н.у. хлора вступает в реакцию с гидроксидомм калия в горячем водном растворе, если среди продуктов обнаружено 0,46 моль хлорида калия. Практический выход составляет 25%
  4. K2Cr2O7+Na2O2+H2So4--->Cr2(SO4)3+K2SO4+Na2SO4+H2O
  5. определите объем 0,2н подкисленного раствора дихромата калия, который можно восстановить пероксидом натрия массой 1,56г
  6. Чему равна концентрация раствора уксусной кислоты, рН которого равен 5,2?
  7. Написать уравнение реакции гидролиза в молекулярной и ионной форме для совместного гидролиза хлорида железа(3) и формиата калия Помогите пожалуйстаа(
  8. а) Константа равновесия реакции: А(г)+2В(г)=АВ2(г) равна 2 х 10 в степени(-3). Вычислить скорость реакции в начальный момент, если начальная концентрация вещества А равна концентрации вещества В и составляет 0,4 моль/л? Какова скорость этой реакции к моменту, когда образуется 0,1 моль/л вещества АВ2? б) Записать выражение для константы равновесия следующей реакции: 2NO3(г)+7H2(г)=2NH3(г)+4H2O(ж)
  9. а)Произойдет ли осаждение сульфида ртути при прибавлении к 1л раствора тетроиодомеркуриата калия с молярной концентрацией 0,01моль/л, содержащего 0,05моль йодида калия, 0,05 моль сульфида железа? б) Дать название следующим комплексным соединениям: 1. K[Ag(CN)2] 2. [Cr(NH3)3(H2O)3]Cl3 3. K2[PtI2] в) Написать уравнения реакций: 1. CoCl2 + KSCN(изб)-----> 2. PtCl4 x 4NH3 + AgNO3------> 3. Bi(NO3)3 + KI(изб)----->
  10. На основе метода валентных связей и теории кристалического поля обьяснить образование химической связи в указаных ниже комплексных ионах и указать: а) тип гибридизации орбиталей центрального атома б) геометрическую форму иона или молекулы в)магнитные свойства комплексов г)наличие или отсутствие окраски [FeF6]с зарядом(3-) и [Fe(NH3)6] с зарядом(3+)
  11. а в первом какой был раствор до того как он стал цвета фуксии?
  12. Да разность электроотрицательности элементов
  13. Помогите с задачей пожалуйста... а) Определить степень гидролиза и рН раствора КСN с молярной концентрацией эквивалента 0,005 моль/л? б) Написать уравнения реакции гидролиза в молекулярной и ионной форме следующих солей: сульфида калия, Сульфата меди, совместного гидролиза хлорида железа(3) и формиата калия?
  14. Какое из указаных соединений водорода является наиболее ионным: LiH, CsH, HF, HI ? Свой выбор доказать расчетом.
  15. Давление пара воды при 26 С составляет 3167 Па. Вычислить для той же температуры давление пара раствора, в 450 г которого содержится 90г глюкозы??
  16. Давление пара воды при 26 С составляет 3167 Па. Вычислить для той же температуры давление пара раствора, в 450 г которого содержится 90г глюкозы??
  17. 1)КМnO4 + H2SO4 + KNO2 2) КМnO4 +H2O + KNO2 3) КМnO + KOH + KNO2 Каким цветом станет раствор во всех трех случаях?? срочно, помогите пожалуйста(
  18. а) Вычислить степень диссоциации и концентрацию Н+ в растворе уксусной кислоты с молярной концентрацией 0,3 моль/л? б) Чему равна концентрация раствора уксцсной кислоты, рН которого равен 5,2?
  • Создать...