Перейти к публикации
Форум химиков на XuMuK.ru

органические реакции


амфибия

Рекомендованные сообщения

Решение задач, рефераты, курсовые - онлайн сервис помощи учащимся. Цены в 2-3 раза ниже!

Буду безмерно признательна за помощь :ah:

 

С6H5CH3 + любая кислота Льюиса =

 

C6H5CH2NH2 + HNO3+ HCl = A

A+KI=

 

(CH3)2CHCOH (2-метилпропаналь)+HCN =

(CH3)2CHClCOH (2-хлорпропаналь) + HCN =

 

C4H9Cl + KCN (водн. р-р)=

C4H9Cl + C2H5NaO (водн. р-р)=

C4H9Cl + водный р-р щелочи =

 

(CH3)2CHCH(OH)CH(CH3)2 (диизопропилкарбинол) +2Na =

 

бензол -> орто-нитрохлорбензол

бензол -> мета-нитрохлорбензол

 

нафталин -> a-нафтиламин

Ссылка на сообщение

С6H5CH3 + любая кислота Льюиса = ??? Что реагирует с толуолом в присутствии кислоты Льюиса?

 

C6H5CH2NH2 + HNO3+ HCl = A (A = C6H5CH2Cl)

A+KI= C6H5CH2J + KCl

 

(CH3)2CHCOH (2-метилпропаналь)+HCN = (CH3)2CHC(OH)-CN

(CH3)2CHClCOH (2-хлорпропаналь) + HCN = (CH3)2CH(CN)COH + HCl

 

C4H9Cl + KCN (водн. р-р)= C4H9-CN

C4H9Cl + C2H5NaO (водн. р-р)= C4H9-O-C2H5

C4H9Cl + водный р-р щелочи = C4H9-OH

 

(CH3)2CHCH(OH)CH(CH3)2 (диизопропилкарбинол) +2Na = (CH3)2CHCH(ONa)CH(CH3)2

 

бензол -> орто-нитрохлорбензол (C6H6 --(Cl2, AlCl3)--> C6H5Cl --(HNO3, H2SO4)--> o- + п-нитрохлорбензол)

бензол -> мета-нитрохлорбензол (С6H6 --(HNO3, H2SO4)--> C6H5-NO2 --(Cl2, AlCl3)--> м-нитрохлорбензол)

 

нафталин -> a-нафтиламин (нафталин --(H2SO4)--> 1-нафталинсульфокислота --(3NaOH, -Na2SO3)--> 1-нафтолят натрия --(HCl, -NaCl)--> 1-нафтол --(NH4HSO3)--> 1-нафтиламин

Ссылка на сообщение

С6H5CH3 + C6H5OH??+ любая кислота Льюиса = (Напишите уравнения бензола и толуола в присутствии кислоты Льюиса)

 

 

C4H9Cl + KCN (водн. р-р)= C4H9-CN цианидбутана?

C4H9Cl + C2H5NaO (водн. р-р)= C4H9-O-C2H5 этилбутиловыйэфир?

 

1-нафтолят натрия можно формулу?

Ссылка на сообщение

С6H5CH3 + C6H5OH??+ любая кислота Льюиса = (Напишите уравнения бензола и толуола в присутствии кислоты Льюиса)

Так и не понятно осталось - с чем реакции... Ну, вот например:

С6H6 + CH3COCl --(AlCl3)--> C6H5-COCH3 (ацетофенон, или фенилметилкетон) + HCl

CH3С6H5 + Br2 --(FeBr3)--> CH3-C6H4-Br (4-бромтолуол) + HBr

 

C4H9Cl + KCN (водн. р-р)= C4H9-CN цианидбутана?

C4H9CN пентанонитрил, или 1-цианобутан, или н-бутилцианид

 

C4H9Cl + C2H5NaO (водн. р-р)= C4H9-O-C2H5 этилбутиловыйэфир?

правильно

 

1-нафтолят натрия можно формулу?

86494.gif
Ссылка на сообщение

Ефим,я от вас не отстану, последние мои вопросы :wub: Извиняюсь,что всё в одной теме написала.

 

С2H5Br+ HCN ? = С2H5CN +HBr

С2H5CN + ??? =C2H5COOH

C2H5COOH + ??? = C2H5COOC2H5

 

написать формулы

диметилэтилпропилметан

2,3-диметилпентан

3-метил-4,4-диэтилгептан

 

какие гомологи бензола образуются при полимеризации 1.метилацетилена 2. ацетилена и метилацетилена

 

Напишите структурную формулу C3H6O2, если водный раствор его имеет кислую реакцию,а при прокаливании его натриевой соли со щелочью образуется этан. Подтвердите ответ уравнениями.

 

межмолекулярная дегидротация: 2-пропанола -> CH3-CH-CH30CH3-CH-CH3 ???

2-метил-2-бутанола -> ???

Ссылка на сообщение

С2H5Br+ HCN ? = С2H5CN +HBr

С2H5CN + ??? =C2H5COOH

C2H5COOH + ??? = C2H5COOC2H5

С2H5Br + KCN = C2H5CN (пропионитрил, или этилцианид) + KBr

С2H5CN + 2H2O + HCl = C2H5COOH (пропионовая кислота) + NH4Cl

C2H5COOH + C2H5OH (H2SO4) = C2H5COOC2H5 (этилпропионат) + H2O

 

написать формулы

диметилэтилпропилметан CH3-CH2-CH2-C(CH3)2-CH2-CH3

2,3-диметилпентан CH3-CH(CH3)-CH(CH3)-CH2-CH3

3-метил-4,4-диэтилгептан CH3-CH2-C(CH3)-C(C2H5)2-CH2-CH2-CH3

 

какие гомологи бензола образуются при полимеризации 1.метилацетилена 2. ацетилена и метилацетилена

post-42262-0-73287200-1321618094_thumb.png

 

Напишите структурную формулу C3H6O2, если водный раствор его имеет кислую реакцию,а при прокаливании его натриевой соли со щелочью образуется этан. Подтвердите ответ уравнениями.

CH3-CH2-COOH пропионовая (или пропановая) кислота

CH3-CH2-COOH = CH3-CH2-COO- + H+ (диссоциация)

CH3-CH2-COONa + NaOH = СH3-CH3 + Na2CO3

 

межмолекулярная дегидротация: 2-пропанола -> CH3-CH-CH30CH3-CH-CH3 ???

2-метил-2-бутанола -> ???

(CH3)2CH-OH ----> (CH3)2CH-O-CH(CH3)2

СH3-CH2-C(CH3)2-OH ----> CH3-CH2-C(CH3)2-O-C(CH3)2-CH2-CH3

Ссылка на сообщение

Архивировано

Эта тема находится в архиве и закрыта для публикации сообщений.

  • Сейчас на странице   0 пользователей

    Нет пользователей, просматривающих эту страницу.

×
×
  • Создать...
Яндекс.Метрика