Перейти к публикации
Форум химиков на XuMuK.ru

Архивировано

Эта тема находится в архиве и закрыта для публикации сообщений.

Mary123

Задача на концентрацию H+ и pH, помогите пожалуйста.

Рекомендованные сообщения

Чему равна концетрация ионов H+ и pH раствора, если к 1 л 0,1 М раствора уксусной кислоты добавить 8,2 г ацетата натрия?

Помогите пожалуйста с решением, получается ответ не верный.

Ответ к задаче 4,73

Поделиться сообщением


Ссылка на сообщение

Я могу ошибаться, но pH в ацетатном буфере равно

pH = pKa + p(C(CH3COOH)/C(CH3COONa)), т.к lg1 = 0, то pH = pKa

Поделиться сообщением


Ссылка на сообщение

Чему равна концентрация ионов H+ и pH раствора, если к 1 литру 0,1 М раствора уксусной кислоты добавить 8,2 г ацетата натрия?

Помогите пожалуйста с задачей, не выходит ответ, может не так решаю. По возможности напишите реакцию и по шагам что и откуда берется, слаба в химии(

Поделиться сообщением


Ссылка на сообщение

Как решаете?

Ну для начала хорошо бы реакцию) а вот с ней запара. Решала через формулы.

n=m/M=8,2/M(CH3COOH)

Cсоли=n/V

[H+]=Кд*Cкислоты/Cсоли

pH=-lg[H+]

Поделиться сообщением


Ссылка на сообщение

В принципе я Вам написал выше готовую формулу, дабы не делать ее вывод

Поделиться сообщением


Ссылка на сообщение

В принципе я Вам написал выше готовую формулу, дабы не делать ее вывод

А можете написать реакцию по задаче? пожалуйста.

Поделиться сообщением


Ссылка на сообщение

CH3COO(-) + H2O = CH3COOH + OH(-)

CH3COOH + H2O = CH3COO(-) + H3O(+)

 

K = [CH3COO(-)]*{H3O(+)] / [CH3COOH]

[H3O(+)] = K*[CH3COOH]/[CH3COO(-)]

И тут вводятся некоторые условности в связи с тем что, степень диссоциации слабой кислоты мала, а именно

[CH3COOH] = C(CH3COOH)

[CH3COO(-)] = C(CH3COONa)

K = 1.74 * 10-5

[H3O(+)] = 1.74*10-5 * 0.1/0.1 = 1.74*10-5

pH = -lg(1.74*10-5) = 4.76

Поделиться сообщением


Ссылка на сообщение

CH3COO(-) + H2O = CH3COOH + OH(-)

CH3COOH + H2O = CH3COO(-) + H3O(+)

 

K = [CH3COO(-)]*{H3O(+)] / [CH3COOH]

[H3O(+)] = K*[CH3COOH]/[CH3COO(-)]

И тут вводятся некоторые условности в связи с тем что, степень диссоциации слабой кислоты мала, а именно

[CH3COOH] = C(CH3COOH)

[CH3COO(-)] = C(CH3COONa)

K = 1.74 * 10-5

[H3O(+)] = 1.74*10-5 * 0.1/0.1 = 1.74*10-5

pH = -lg(1.74*10-5) = 4.76

спасибо большое)

Поделиться сообщением


Ссылка на сообщение

  • Сейчас на странице   0 пользователей

    Нет пользователей, просматривающих эту страницу.

×
×
  • Создать...