Перейти к публикации
Форум химиков на XuMuK.ru
evgeniywinner

Уравнение в ионно-молекулярной форме.

Рекомендованные сообщения

Доброго времени суток.

 

Заранее благодарю за помощь.

 

Имеются 2 уравнения:

 

Pb(OH)2+2HCI=PbCI2+2H2O

 

Pb(OH)2+2Na(OH)=Na2[Pb(OH)4]

 

Напишите, пожалуйста, эти же уравнения в ионно-молекулярной форме.

У меня есть предположение только относительно первого, но не знаю насколько верное: Pb(OH)2+2H=Pb+2H2O

 

И еще помогите написать электролитическую диссоциацию  NaH2PO3

 

Заранее спасибо!

Поделиться сообщением


Ссылка на сообщение

Pb(OH)2+2HCl=PbCl2+2H2O

Pb(OH)2 + 2H+ = Pb2+ + 2H2O

 

Pb(OH)2+2NaOH=Na2(Pb(OH)4)

Pb(OH)2 + 2OH- = (Pb(OH)4)2-

 

Диссоциация NaH2PO4:

NaH2PO4=Na+ + H2PO4-

H2PO4- = HPO42- + H+

HPO4- = H+ + PO4 3-

Спасибо, но мне нужна диссоциация NaH2PO3

Поделиться сообщением


Ссылка на сообщение

Это и есть диссоциация дигидрофосфата натрия

Диссоциация NaH2PO4:

NaH2PO4=Na+ + H2PO4-

H2PO4- = HPO42- + H+

HPO4- = H+ + PO4 3-

Надо учитывать, что дигидрофосфат-ион тоже диссоциирует.

По большей части диссоциации будет идти так:

NaH2PO4=Na+ + H2PO4-

Поделиться сообщением


Ссылка на сообщение

Это и есть диссоциация дигидрофосфата натрия

 

Спасибо, но мне нужна диссоциация NaH2PO3

Поделиться сообщением


Ссылка на сообщение

Помогите расставить коэффициенты в уравнениях: FeCl3 +KI = FeCl2 + I2 +KCl; KMnO4 +FeSO4= MnSO4 + K2SO4 + Fe2(SO4) + H2O; CuSO4 + KI + крахмал = I2 + Cr2SO4 + K2SO4; KMnO4 +H2SO4 + NaSO3 = Na2SO4 + MnSO4 + K2SO4 + H2O

 

Извините не знаю как написать подстрочные цифры. Помогите Пожалуйста Расставить коэффициенты. С уважением Alex

Поделиться сообщением


Ссылка на сообщение

Помогите расставить коэффициенты в уравнениях: FeCl3 +KI = FeCl2 + I2 +KCl; KMnO4 +FeSO4= MnSO4 + K2SO4 + Fe2(SO4) + H2O; CuSO4 + KI + крахмал = I2 + Cr2SO4 + K2SO4; KMnO4 +H2SO4 + NaSO3 = Na2SO4 + MnSO4 + K2SO4 + H2O

 

Извините не знаю как написать подстрочные цифры. Помогите Пожалуйста Расставить коэффициенты. С уважением Alex

не верное  равнение

чушь

Поделиться сообщением


Ссылка на сообщение

не верное  равнение

чушь

А в чем чушь? Эти уравнения дала нам учитель химии, они из серии окислительно-восстановительные реакции, задание уравнять левую и правую часть уравнений. Всем заранее благодарен. 

Поделиться сообщением


Ссылка на сообщение

А в чем чушь? Эти уравнения дала нам учитель химии, они из серии окислительно-восстановительные реакции, задание уравнять левую и правую часть уравнений. Всем заранее благодарен. 

Потому что учительница, вероятно, все написала все верно, но вы даже не смогли правильно списать.

Изменено пользователем aversun

Поделиться сообщением


Ссылка на сообщение

Присоединяйтесь к обсуждению

Вы можете опубликовать сообщение сейчас, а зарегистрироваться позже. Если у вас есть аккаунт, войдите в него для написания от своего имени.
Примечание: вашему сообщению потребуется утверждение модератора, прежде чем оно станет доступным.

Гость
Ответить в тему...

×   Вставлено в виде отформатированного текста.   Вставить в виде обычного текста

  Разрешено не более 75 эмодзи.

×   Ваша ссылка была автоматически встроена.   Отобразить как ссылку

×   Ваш предыдущий контент был восстановлен.   Очистить редактор

×   Вы не можете вставить изображения напрямую. Загрузите или вставьте изображения по ссылке.

Загрузка...

  • Сейчас на странице   0 пользователей

    Нет пользователей, просматривающих эту страницу.

×
×
  • Создать...