Перейти к содержанию
Форум химиков на XuMuK.ru

Уравнение в ионно-молекулярной форме.


Рекомендуемые сообщения

Решение задач, рефераты, курсовые! Онлайн сервис помощи учащимся. Цены в 2-3 раза ниже!

Доброго времени суток.

 

Заранее благодарю за помощь.

 

Имеются 2 уравнения:

 

Pb(OH)2+2HCI=PbCI2+2H2O

 

Pb(OH)2+2Na(OH)=Na2[Pb(OH)4]

 

Напишите, пожалуйста, эти же уравнения в ионно-молекулярной форме.

У меня есть предположение только относительно первого, но не знаю насколько верное: Pb(OH)2+2H=Pb+2H2O

 

И еще помогите написать электролитическую диссоциацию  NaH2PO3

 

Заранее спасибо!

  • Like 1
Ссылка на комментарий

Pb(OH)2+2HCl=PbCl2+2H2O

Pb(OH)2 + 2H+ = Pb2+ + 2H2O

 

Pb(OH)2+2NaOH=Na2(Pb(OH)4)

Pb(OH)2 + 2OH- = (Pb(OH)4)2-

 

Диссоциация NaH2PO4:

NaH2PO4=Na+ + H2PO4-

H2PO4- = HPO42- + H+

HPO4- = H+ + PO4 3-

Спасибо, но мне нужна диссоциация NaH2PO3

Ссылка на комментарий

Это и есть диссоциация дигидрофосфата натрия

Диссоциация NaH2PO4:

NaH2PO4=Na+ + H2PO4-

H2PO4- = HPO42- + H+

HPO4- = H+ + PO4 3-

Надо учитывать, что дигидрофосфат-ион тоже диссоциирует.

По большей части диссоциации будет идти так:

NaH2PO4=Na+ + H2PO4-

Ссылка на комментарий
  • 3 недели спустя...

Помогите расставить коэффициенты в уравнениях: FeCl3 +KI = FeCl2 + I2 +KCl; KMnO4 +FeSO4= MnSO4 + K2SO4 + Fe2(SO4) + H2O; CuSO4 + KI + крахмал = I2 + Cr2SO4 + K2SO4; KMnO4 +H2SO4 + NaSO3 = Na2SO4 + MnSO4 + K2SO4 + H2O

 

Извините не знаю как написать подстрочные цифры. Помогите Пожалуйста Расставить коэффициенты. С уважением Alex

Ссылка на комментарий

Помогите расставить коэффициенты в уравнениях: FeCl3 +KI = FeCl2 + I2 +KCl; KMnO4 +FeSO4= MnSO4 + K2SO4 + Fe2(SO4) + H2O; CuSO4 + KI + крахмал = I2 + Cr2SO4 + K2SO4; KMnO4 +H2SO4 + NaSO3 = Na2SO4 + MnSO4 + K2SO4 + H2O

 

Извините не знаю как написать подстрочные цифры. Помогите Пожалуйста Расставить коэффициенты. С уважением Alex

не верное  равнение

чушь

Ссылка на комментарий
  • 3 недели спустя...

не верное  равнение

чушь

А в чем чушь? Эти уравнения дала нам учитель химии, они из серии окислительно-восстановительные реакции, задание уравнять левую и правую часть уравнений. Всем заранее благодарен. 

Ссылка на комментарий

А в чем чушь? Эти уравнения дала нам учитель химии, они из серии окислительно-восстановительные реакции, задание уравнять левую и правую часть уравнений. Всем заранее благодарен. 

Потому что учительница, вероятно, все написала все верно, но вы даже не смогли правильно списать.

Изменено пользователем aversun
Ссылка на комментарий

Для публикации сообщений создайте учётную запись или авторизуйтесь

Вы должны быть пользователем, чтобы оставить комментарий

Создать учетную запись

Зарегистрируйте новую учётную запись в нашем сообществе. Это очень просто!

Регистрация нового пользователя

Войти

Уже есть аккаунт? Войти в систему.

Войти
  • Последние посетители   0 пользователей онлайн

    • Ни одного зарегистрированного пользователя не просматривает данную страницу
×
×
  • Создать...
Яндекс.Метрика